C13H17FN6O — CID 176723754
3-(fluoromethyl)-1-[5-methyl-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]azetidin-3-ol (PubChem CID 176723754) has the molecular formula C13H17FN6O and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-(fluoromethyl)-1-[5-methyl-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]azetidin-3-ol.
| Compound Name | 3-(fluoromethyl)-1-[5-methyl-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]azetidin-3-ol |
|---|---|
| PubChem CID | 176723754 |
| Molecular Formula | C13H17FN6O |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-(fluoromethyl)-1-[5-methyl-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]azetidin-3-ol |
| SMILES | Cc1cnc(Nc2cnn(C)c2)nc1N1CC(O)(CF)C1 |
| InChI | InChI=1S/C13H17FN6O/c1-9-3-15-12(17-10-4-16-19(2)5-10)18-11(9)20-7-13(21,6-14)8-20/h3-5,21H,6-8H2,1-2H3,(H,15,17,18) |
| InChIKey | BYPPNVFIORHUDV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |