C29H32N6O4 — CID 135283176
2-(2-methylprop-2-enoylamino)ethyl N-[[4-[[4-amino-2-(oxolan-2-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate (PubChem CID 135283176) has the molecular formula C29H32N6O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoylamino)ethyl N-[[4-[[4-amino-2-(oxolan-2-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate.
| Compound Name | 2-(2-methylprop-2-enoylamino)ethyl N-[[4-[[4-amino-2-(oxolan-2-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 135283176 |
| Molecular Formula | C29H32N6O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 2-(2-methylprop-2-enoylamino)ethyl N-[[4-[[4-amino-2-(oxolan-2-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate |
| SMILES | C=C(C)C(=O)NCCOC(=O)NCc1ccc(Cn2c(C3CCCO3)nc3c(N)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C29H32N6O4/c1-18(2)28(36)31-13-15-39-29(37)32-16-19-9-11-20(12-10-19)17-35-25-21-6-3-4-7-22(21)33-26(30)24(25)34-27(35)23-8-5-14-38-23/h3-4,6-7,9-12,23H,1,5,8,13-17H2,2H3,(H2,30,33)(H,31,36)(H,32,37) |
| InChIKey | IZWDGCISQZINBQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|