C29H30N6O2S — CID 135282945
2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate (PubChem CID 135282945) has the molecular formula C29H30N6O2S and a molecular weight of 526.67 g/mol. Its IUPAC name is 2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate.
| Compound Name | 2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 135282945 |
| Molecular Formula | C29H30N6O2S |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate |
| SMILES | C=C(C)CNCCOC(=O)NCc1ccc(Cn2c(-c3cccs3)nc3c(N)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C29H30N6O2S/c1-19(2)16-31-13-14-37-29(36)32-17-20-9-11-21(12-10-20)18-35-26-22-6-3-4-7-23(22)33-27(30)25(26)34-28(35)24-8-5-15-38-24/h3-12,15,31H,1,13-14,16-18H2,2H3,(H2,30,33)(H,32,36) |
| InChIKey | FINWEWJAWHSCNR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|