C29H30N8O2 — CID 135282982
2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-pyrazin-2-ylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate (PubChem CID 135282982) has the molecular formula C29H30N8O2 and a molecular weight of 522.61 g/mol. Its IUPAC name is 2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-pyrazin-2-ylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate.
| Compound Name | 2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-pyrazin-2-ylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 135282982 |
| Molecular Formula | C29H30N8O2 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-pyrazin-2-ylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate |
| SMILES | C=C(C)CNCCOC(=O)NCc1ccc(Cn2c(-c3cnccn3)nc3c(N)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C29H30N8O2/c1-19(2)15-32-13-14-39-29(38)34-16-20-7-9-21(10-8-20)18-37-26-22-5-3-4-6-23(22)35-27(30)25(26)36-28(37)24-17-31-11-12-33-24/h3-12,17,32H,1,13-16,18H2,2H3,(H2,30,35)(H,34,38) |
| InChIKey | FZCXPGBGVLWXAS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|