C28H29N7O2S — CID 135283092
2-(2-methylprop-2-enylamino)ethyl N-[[4-[[4-amino-2-(1,2-thiazol-4-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate (PubChem CID 135283092) has the molecular formula C28H29N7O2S and a molecular weight of 527.65 g/mol. Its IUPAC name is 2-(2-methylprop-2-enylamino)ethyl N-[[4-[[4-amino-2-(1,2-thiazol-4-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate.
| Compound Name | 2-(2-methylprop-2-enylamino)ethyl N-[[4-[[4-amino-2-(1,2-thiazol-4-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 135283092 |
| Molecular Formula | C28H29N7O2S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 2-(2-methylprop-2-enylamino)ethyl N-[[4-[[4-amino-2-(1,2-thiazol-4-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate |
| SMILES | C=C(C)CNCCOC(=O)NCc1ccc(Cn2c(-c3cnsc3)nc3c(N)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C28H29N7O2S/c1-18(2)13-30-11-12-37-28(36)31-14-19-7-9-20(10-8-19)16-35-25-22-5-3-4-6-23(22)33-26(29)24(25)34-27(35)21-15-32-38-17-21/h3-10,15,17,30H,1,11-14,16H2,2H3,(H2,29,33)(H,31,36) |
| InChIKey | VPNVSFBGZKZOBJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|