C27H41N9O3 — CID 162372989
tert-butyl N-[(2S)-1-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate (PubChem CID 162372989) has the molecular formula C27H41N9O3 and a molecular weight of 539.69 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 162372989 |
| Molecular Formula | C27H41N9O3 |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.33 |
| IUPAC Name | tert-butyl N-[(2S)-1-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCNC(=O)[C@H](CCCN=C(N)N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H41N9O3/c1-5-6-13-20-35-21-22(17-10-7-8-11-18(17)33-23(21)28)36(20)16-15-31-24(37)19(12-9-14-32-25(29)30)34-26(38)39-27(2,3)4/h7-8,10-11,19H,5-6,9,12-16H2,1-4H3,(H2,28,33)(H,31,37)(H,34,38)(H4,29,30,32)/t19-/m0/s1 |
| InChIKey | FXGZMTIBDHQUKX-IBGZPJMESA-N |
| XLogP | 2.57 |
| TPSA | 188.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|