C24H31N7O2 — CID 177290896
tert-butyl N-[(E)-4-(4-azido-2-butylimidazo[4,5-c]quinolin-1-yl)-3-methylbut-2-enyl]carbamate (PubChem CID 177290896) has the molecular formula C24H31N7O2 and a molecular weight of 449.56 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-(4-azido-2-butylimidazo[4,5-c]quinolin-1-yl)-3-methylbut-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-(4-azido-2-butylimidazo[4,5-c]quinolin-1-yl)-3-methylbut-2-enyl]carbamate |
|---|---|
| PubChem CID | 177290896 |
| Molecular Formula | C24H31N7O2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | tert-butyl N-[(E)-4-(4-azido-2-butylimidazo[4,5-c]quinolin-1-yl)-3-methylbut-2-enyl]carbamate |
| SMILES | CCCCc1nc2c(N=[N+]=[N-])nc3ccccc3c2n1C/C(C)=C/CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31N7O2/c1-6-7-12-19-28-20-21(17-10-8-9-11-18(17)27-22(20)29-30-25)31(19)15-16(2)13-14-26-23(32)33-24(3,4)5/h8-11,13H,6-7,12,14-15H2,1-5H3,(H,26,32)/b16-13+ |
| InChIKey | MJDVWADIMJZZPG-DTQAZKPQSA-N |
| XLogP | 6.34 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|