C22H29N3O2S — CID 67052471
2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline (PubChem CID 67052471) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline.
| Compound Name | 2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 67052471 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline |
| SMILES | CSCCCCCn1c(CCC2(C)OCCO2)nc2cnc3ccccc3c21 |
| InChI | InChI=1S/C22H29N3O2S/c1-22(26-13-14-27-22)11-10-20-24-19-16-23-18-9-5-4-8-17(18)21(19)25(20)12-6-3-7-15-28-2/h4-5,8-9,16H,3,6-7,10-15H2,1-2H3 |
| InChIKey | CDTWLURRRNUNDF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|