C14H22N4O — CID 141155477
4-[2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butan-1-amine (PubChem CID 141155477) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-[2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butan-1-amine.
| Compound Name | 4-[2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 141155477 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-[2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butan-1-amine |
| SMILES | CCOCc1nc2cnc(C)cc2n1CCCCN |
| InChI | InChI=1S/C14H22N4O/c1-3-19-10-14-17-12-9-16-11(2)8-13(12)18(14)7-5-4-6-15/h8-9H,3-7,10,15H2,1-2H3 |
| InChIKey | QDMHTOHRWFAQAF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|