C20H23Cl2N3S — CID 69193259
1-[3-(2,4-dichlorophenyl)sulfanylpropyl]-6,7-dimethyl-2-propylimidazo[4,5-c]pyridine (PubChem CID 69193259) has the molecular formula C20H23Cl2N3S and a molecular weight of 408.40 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenyl)sulfanylpropyl]-6,7-dimethyl-2-propylimidazo[4,5-c]pyridine.
| Compound Name | 1-[3-(2,4-dichlorophenyl)sulfanylpropyl]-6,7-dimethyl-2-propylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 69193259 |
| Molecular Formula | C20H23Cl2N3S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 1-[3-(2,4-dichlorophenyl)sulfanylpropyl]-6,7-dimethyl-2-propylimidazo[4,5-c]pyridine |
| SMILES | CCCc1nc2cnc(C)c(C)c2n1CCCSc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H23Cl2N3S/c1-4-6-19-24-17-12-23-14(3)13(2)20(17)25(19)9-5-10-26-18-8-7-15(21)11-16(18)22/h7-8,11-12H,4-6,9-10H2,1-3H3 |
| InChIKey | NTZFORMAMXDVBH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|