C10H18ClN3 — CID 63384290
3-chloro-4-pentan-3-yl-5-propyl-1,2,4-triazole (PubChem CID 63384290) has the molecular formula C10H18ClN3 and a molecular weight of 215.73 g/mol. Its IUPAC name is 3-chloro-4-pentan-3-yl-5-propyl-1,2,4-triazole.
| Compound Name | 3-chloro-4-pentan-3-yl-5-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 63384290 |
| Molecular Formula | C10H18ClN3 |
| Molecular Weight | 215.73 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-chloro-4-pentan-3-yl-5-propyl-1,2,4-triazole |
| SMILES | CCCc1nnc(Cl)n1C(CC)CC |
| InChI | InChI=1S/C10H18ClN3/c1-4-7-9-12-13-10(11)14(9)8(5-2)6-3/h8H,4-7H2,1-3H3 |
| InChIKey | GFAXROMRVUMASL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |