C25H21N3 — CID 123203445
3-isocyano-4,5-diphenyl-1-(2-phenylethyl)pyrrol-2-amine (PubChem CID 123203445) has the molecular formula C25H21N3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-isocyano-4,5-diphenyl-1-(2-phenylethyl)pyrrol-2-amine.
| Compound Name | 3-isocyano-4,5-diphenyl-1-(2-phenylethyl)pyrrol-2-amine |
|---|---|
| PubChem CID | 123203445 |
| Molecular Formula | C25H21N3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-isocyano-4,5-diphenyl-1-(2-phenylethyl)pyrrol-2-amine |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)c(-c2ccccc2)n(CCc2ccccc2)c1N |
| InChI | InChI=1S/C25H21N3/c1-27-23-22(20-13-7-3-8-14-20)24(21-15-9-4-10-16-21)28(25(23)26)18-17-19-11-5-2-6-12-19/h2-16H,17-18,26H2 |
| InChIKey | DXLKVVUUFTWNNO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 35.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|