C18H31NO3Si — CID 21024249
triethoxy-[1-(3-phenylpropyl)azetidin-2-yl]silane (PubChem CID 21024249) has the molecular formula C18H31NO3Si and a molecular weight of 337.54 g/mol. Its IUPAC name is triethoxy-[1-(3-phenylpropyl)azetidin-2-yl]silane.
| Compound Name | triethoxy-[1-(3-phenylpropyl)azetidin-2-yl]silane |
|---|---|
| PubChem CID | 21024249 |
| Molecular Formula | C18H31NO3Si |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | triethoxy-[1-(3-phenylpropyl)azetidin-2-yl]silane |
| SMILES | CCO[Si](OCC)(OCC)C1CCN1CCCc1ccccc1 |
| InChI | InChI=1S/C18H31NO3Si/c1-4-20-23(21-5-2,22-6-3)18-14-16-19(18)15-10-13-17-11-8-7-9-12-17/h7-9,11-12,18H,4-6,10,13-16H2,1-3H3 |
| InChIKey | SBQBKWSVFQHGDM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|