C21H37NO3Si — CID 21024256
trimethoxy-[1-(2-phenylethyl)-azacycloundec-2-yl]silane (PubChem CID 21024256) has the molecular formula C21H37NO3Si and a molecular weight of 379.62 g/mol. Its IUPAC name is trimethoxy-[1-(2-phenylethyl)-azacycloundec-2-yl]silane.
| Compound Name | trimethoxy-[1-(2-phenylethyl)-azacycloundec-2-yl]silane |
|---|---|
| PubChem CID | 21024256 |
| Molecular Formula | C21H37NO3Si |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | trimethoxy-[1-(2-phenylethyl)-azacycloundec-2-yl]silane |
| SMILES | CO[Si](OC)(OC)C1CCCCCCCCCN1CCc1ccccc1 |
| InChI | InChI=1S/C21H37NO3Si/c1-23-26(24-2,25-3)21-16-12-7-5-4-6-8-13-18-22(21)19-17-20-14-10-9-11-15-20/h9-11,14-15,21H,4-8,12-13,16-19H2,1-3H3 |
| InChIKey | JKVKUZRTIFREMN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|