C17H29NO2Si — CID 21024225
dimethoxy-methyl-[1-(2-phenylethyl)azepan-2-yl]silane (PubChem CID 21024225) has the molecular formula C17H29NO2Si and a molecular weight of 307.51 g/mol. Its IUPAC name is dimethoxy-methyl-[1-(2-phenylethyl)azepan-2-yl]silane.
| Compound Name | dimethoxy-methyl-[1-(2-phenylethyl)azepan-2-yl]silane |
|---|---|
| PubChem CID | 21024225 |
| Molecular Formula | C17H29NO2Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | dimethoxy-methyl-[1-(2-phenylethyl)azepan-2-yl]silane |
| SMILES | CO[Si](C)(OC)C1CCCCCN1CCc1ccccc1 |
| InChI | InChI=1S/C17H29NO2Si/c1-19-21(3,20-2)17-12-8-5-9-14-18(17)15-13-16-10-6-4-7-11-16/h4,6-7,10-11,17H,5,8-9,12-15H2,1-3H3 |
| InChIKey | OPDGQOAIJXNECX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|