C8H10N4O2S — CID 78199907
4-methyl-4a,7,8,9a-tetrahydropurino[8,7-b][1,3]thiazole-1,3-dione (PubChem CID 78199907) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is 4-methyl-4a,7,8,9a-tetrahydropurino[8,7-b][1,3]thiazole-1,3-dione.
| Compound Name | 4-methyl-4a,7,8,9a-tetrahydropurino[8,7-b][1,3]thiazole-1,3-dione |
|---|---|
| PubChem CID | 78199907 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 4-methyl-4a,7,8,9a-tetrahydropurino[8,7-b][1,3]thiazole-1,3-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C1SCCN12 |
| InChI | InChI=1S/C8H10N4O2S/c1-11-5-4(6(13)10-7(11)14)12-2-3-15-8(12)9-5/h4-5H,2-3H2,1H3,(H,10,13,14) |
| InChIKey | UFKZSIUDVYATOS-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |