C8H13N5O2 — CID 78302943
8-amino-7-ethyl-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 78302943) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 8-amino-7-ethyl-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-amino-7-ethyl-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78302943 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 8-amino-7-ethyl-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCN1C(N)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C8H13N5O2/c1-3-13-4-5(10-7(13)9)12(2)8(15)11-6(4)14/h4-5H,3H2,1-2H3,(H2,9,10)(H,11,14,15) |
| InChIKey | OGCXNCZDJVCHMJ-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |