C7H12N6O2 — CID 85204308
8-hydrazinyl-3,7-dimethyl-4,5-dihydropurine-2,6-dione (PubChem CID 85204308) has the molecular formula C7H12N6O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 8-hydrazinyl-3,7-dimethyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-hydrazinyl-3,7-dimethyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 85204308 |
| Molecular Formula | C7H12N6O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 8-hydrazinyl-3,7-dimethyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(NN)N2C |
| InChI | InChI=1S/C7H12N6O2/c1-12-3-4(9-6(12)11-8)13(2)7(15)10-5(3)14/h3-4H,8H2,1-2H3,(H,9,11)(H,10,14,15) |
| InChIKey | KQZUKMVYWBOJHY-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|