C13H23N5O2 — CID 78303009
8-(dimethylamino)-3-methyl-7-pentyl-4,5-dihydropurine-2,6-dione (PubChem CID 78303009) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 8-(dimethylamino)-3-methyl-7-pentyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-(dimethylamino)-3-methyl-7-pentyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78303009 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 8-(dimethylamino)-3-methyl-7-pentyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCCN1C(N(C)C)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C13H23N5O2/c1-5-6-7-8-18-9-10(14-12(18)16(2)3)17(4)13(20)15-11(9)19/h9-10H,5-8H2,1-4H3,(H,15,19,20) |
| InChIKey | CVQOEYHJTQIFAD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|