C15H26N6O2 — CID 78302977
3-methyl-7-pentyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione (PubChem CID 78302977) has the molecular formula C15H26N6O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-methyl-7-pentyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-methyl-7-pentyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78302977 |
| Molecular Formula | C15H26N6O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 3-methyl-7-pentyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCCN1C(N2CCNCC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C15H26N6O2/c1-3-4-5-8-21-11-12(19(2)15(23)18-13(11)22)17-14(21)20-9-6-16-7-10-20/h11-12,16H,3-10H2,1-2H3,(H,18,22,23) |
| InChIKey | LXAVXVVGEWLMKT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|