C18H31N7O3 — CID 73282258
2-[4-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperazin-1-yl]acetamide (PubChem CID 73282258) has the molecular formula C18H31N7O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[4-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperazin-1-yl]acetamide.
| Compound Name | 2-[4-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 73282258 |
| Molecular Formula | C18H31N7O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 2-[4-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperazin-1-yl]acetamide |
| SMILES | CCCCCCN1C(N2CCN(CC(N)=O)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C18H31N7O3/c1-3-4-5-6-7-25-14-15(22(2)18(28)21-16(14)27)20-17(25)24-10-8-23(9-11-24)12-13(19)26/h14-15H,3-12H2,1-2H3,(H2,19,26)(H,21,27,28) |
| InChIKey | ODTYEAXPGRIDOG-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|