C19H33N5O2 — CID 78303083
3-methyl-7-octyl-8-piperidin-1-yl-4,5-dihydropurine-2,6-dione (PubChem CID 78303083) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 3-methyl-7-octyl-8-piperidin-1-yl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-methyl-7-octyl-8-piperidin-1-yl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78303083 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 3-methyl-7-octyl-8-piperidin-1-yl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCCCCCN1C(N2CCCCC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C19H33N5O2/c1-3-4-5-6-7-11-14-24-15-16(22(2)19(26)21-17(15)25)20-18(24)23-12-9-8-10-13-23/h15-16H,3-14H2,1-2H3,(H,21,25,26) |
| InChIKey | VANLMHIZSWDKRH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|