C23H32ClFN6O2 — CID 73329024
8-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-7-hexyl-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 73329024) has the molecular formula C23H32ClFN6O2 and a molecular weight of 479.00 g/mol. Its IUPAC name is 8-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-7-hexyl-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-7-hexyl-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 73329024 |
| Molecular Formula | C23H32ClFN6O2 |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 8-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-7-hexyl-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCCCN1C(N2CCN(Cc3c(F)cccc3Cl)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C23H32ClFN6O2/c1-3-4-5-6-10-31-19-20(28(2)23(33)27-21(19)32)26-22(31)30-13-11-29(12-14-30)15-16-17(24)8-7-9-18(16)25/h7-9,19-20H,3-6,10-15H2,1-2H3,(H,27,32,33) |
| InChIKey | ZPLVHEAMRYDMGF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|