C8H14N8O3 — CID 78266829
2-(8-hydrazinyl-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetohydrazide (PubChem CID 78266829) has the molecular formula C8H14N8O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-(8-hydrazinyl-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetohydrazide.
| Compound Name | 2-(8-hydrazinyl-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetohydrazide |
|---|---|
| PubChem CID | 78266829 |
| Molecular Formula | C8H14N8O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(8-hydrazinyl-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetohydrazide |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(NN)N2CC(=O)NN |
| InChI | InChI=1S/C8H14N8O3/c1-15-5-4(6(18)12-8(15)19)16(2-3(17)13-9)7(11-5)14-10/h4-5H,2,9-10H2,1H3,(H,11,14)(H,13,17)(H,12,18,19) |
| InChIKey | RLZCFDKKWOLWPW-UHFFFAOYSA-N |
| XLogP | -4.01 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|