C16H18BrN5O3S — CID 78335060
2-[2-(8-bromo-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)ethylsulfanyl]-N-phenylacetamide (PubChem CID 78335060) has the molecular formula C16H18BrN5O3S and a molecular weight of 440.32 g/mol. Its IUPAC name is 2-[2-(8-bromo-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)ethylsulfanyl]-N-phenylacetamide.
| Compound Name | 2-[2-(8-bromo-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)ethylsulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 78335060 |
| Molecular Formula | C16H18BrN5O3S |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2-[2-(8-bromo-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)ethylsulfanyl]-N-phenylacetamide |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(Br)N2CCSCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H18BrN5O3S/c1-21-13-12(14(24)20-16(21)25)22(15(17)19-13)7-8-26-9-11(23)18-10-5-3-2-4-6-10/h2-6,12-13H,7-9H2,1H3,(H,18,23)(H,20,24,25) |
| InChIKey | LXKWVNWBRJHSRQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|