C21H21ClN6O2 — CID 156589687
7-[(4-chlorophenyl)methyl]-3-methyl-8-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-4,5-dihydropurine-2,6-dione (PubChem CID 156589687) has the molecular formula C21H21ClN6O2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-8-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-8-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 156589687 |
| Molecular Formula | C21H21ClN6O2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-8-[(2E)-2-[(4-methylphenyl)methylidene]hydrazinyl]-4,5-dihydropurine-2,6-dione |
| SMILES | Cc1ccc(/C=N/NC2=NC3C(C(=O)NC(=O)N3C)N2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H21ClN6O2/c1-13-3-5-14(6-4-13)11-23-26-20-24-18-17(19(29)25-21(30)27(18)2)28(20)12-15-7-9-16(22)10-8-15/h3-11,17-18H,12H2,1-2H3,(H,24,26)(H,25,29,30)/b23-11+ |
| InChIKey | MCWGVFUMIFTSAI-FOKLQQMPSA-N |
| XLogP | 2.32 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|