C20H18ClFN6O2 — CID 156590361
8-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-7-[(2-fluorophenyl)methyl]-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 156590361) has the molecular formula C20H18ClFN6O2 and a molecular weight of 428.86 g/mol. Its IUPAC name is 8-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-7-[(2-fluorophenyl)methyl]-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-7-[(2-fluorophenyl)methyl]-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 156590361 |
| Molecular Formula | C20H18ClFN6O2 |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 8-[(2E)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-7-[(2-fluorophenyl)methyl]-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(N/N=C/c1ccccc1Cl)N2Cc1ccccc1F |
| InChI | InChI=1S/C20H18ClFN6O2/c1-27-17-16(18(29)25-20(27)30)28(11-13-7-3-5-9-15(13)22)19(24-17)26-23-10-12-6-2-4-8-14(12)21/h2-10,16-17H,11H2,1H3,(H,24,26)(H,25,29,30)/b23-10+ |
| InChIKey | QZFUVYFEKOSZFS-AUEPDCJTSA-N |
| XLogP | 2.15 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|