C15H16N4O4 — CID 78207647
4-methyl-7-(phenoxymethyl)-4a,7,8,9a-tetrahydropurino[8,7-b][1,3]oxazole-1,3-dione (PubChem CID 78207647) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 4-methyl-7-(phenoxymethyl)-4a,7,8,9a-tetrahydropurino[8,7-b][1,3]oxazole-1,3-dione.
| Compound Name | 4-methyl-7-(phenoxymethyl)-4a,7,8,9a-tetrahydropurino[8,7-b][1,3]oxazole-1,3-dione |
|---|---|
| PubChem CID | 78207647 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-methyl-7-(phenoxymethyl)-4a,7,8,9a-tetrahydropurino[8,7-b][1,3]oxazole-1,3-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C1OC(COc3ccccc3)CN12 |
| InChI | InChI=1S/C15H16N4O4/c1-18-12-11(13(20)17-14(18)21)19-7-10(23-15(19)16-12)8-22-9-5-3-2-4-6-9/h2-6,10-12H,7-8H2,1H3,(H,17,20,21) |
| InChIKey | BDOSCEATDGEODI-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |