C5H8F2N2O — CID 150532585
4,5-difluoro-1,3-dimethylimidazolidin-2-one (PubChem CID 150532585) has the molecular formula C5H8F2N2O and a molecular weight of 150.13 g/mol. Its IUPAC name is 4,5-difluoro-1,3-dimethylimidazolidin-2-one.
| Compound Name | 4,5-difluoro-1,3-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 150532585 |
| Molecular Formula | C5H8F2N2O |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.06 |
| IUPAC Name | 4,5-difluoro-1,3-dimethylimidazolidin-2-one |
| SMILES | CN1C(=O)N(C)C(F)C1F |
| InChI | InChI=1S/C5H8F2N2O/c1-8-3(6)4(7)9(2)5(8)10/h3-4H,1-2H3 |
| InChIKey | IEDWIIRIBOAJAE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|