C9H18N2O3 — CID 143815400
1,3-diethyl-4,5-dimethoxyimidazolidin-2-one (PubChem CID 143815400) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1,3-diethyl-4,5-dimethoxyimidazolidin-2-one.
| Compound Name | 1,3-diethyl-4,5-dimethoxyimidazolidin-2-one |
|---|---|
| PubChem CID | 143815400 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 1,3-diethyl-4,5-dimethoxyimidazolidin-2-one |
| SMILES | CCN1C(=O)N(CC)C(OC)C1OC |
| InChI | InChI=1S/C9H18N2O3/c1-5-10-7(13-3)8(14-4)11(6-2)9(10)12/h7-8H,5-6H2,1-4H3 |
| InChIKey | WQPLAOUXRXLJHZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |