C18H34N4O4 — CID 58468494
3,4-bis(butoxymethyl)-1,6-diethyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 58468494) has the molecular formula C18H34N4O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 3,4-bis(butoxymethyl)-1,6-diethyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 3,4-bis(butoxymethyl)-1,6-diethyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 58468494 |
| Molecular Formula | C18H34N4O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 3,4-bis(butoxymethyl)-1,6-diethyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | CCCCOCN1C(=O)N(CC)C2C1N(COCCCC)C(=O)N2CC |
| InChI | InChI=1S/C18H34N4O4/c1-5-9-11-25-13-21-16-15(19(7-3)17(21)23)20(8-4)18(24)22(16)14-26-12-10-6-2/h15-16H,5-14H2,1-4H3 |
| InChIKey | UOPSPRSICSNYEN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|