C24H47N4O6+ — CID 91023941
3,4,4,6-tetrakis(butoxymethyl)-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-4-ium-2,5-dione (PubChem CID 91023941) has the molecular formula C24H47N4O6+ and a molecular weight of 487.66 g/mol. Its IUPAC name is 3,4,4,6-tetrakis(butoxymethyl)-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-4-ium-2,5-dione.
| Compound Name | 3,4,4,6-tetrakis(butoxymethyl)-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-4-ium-2,5-dione |
|---|---|
| PubChem CID | 91023941 |
| Molecular Formula | C24H47N4O6+ |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.35 |
| IUPAC Name | 3,4,4,6-tetrakis(butoxymethyl)-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-4-ium-2,5-dione |
| SMILES | CCCCOCN1C(=O)[N+](COCCCC)(COCCCC)C2C1NC(=O)N2COCCCC |
| InChI | InChI=1S/C24H46N4O6/c1-5-9-13-31-17-26-21-22(27(23(29)25-21)18-32-14-10-6-2)28(24(26)30,19-33-15-11-7-3)20-34-16-12-8-4/h21-22H,5-20H2,1-4H3/p+1 |
| InChIKey | LTTJUHSEIHQDJS-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|