C21H42N2O5 — CID 46928657
4,5-dibutoxy-1,3-bis(butoxymethyl)imidazolidin-2-one (PubChem CID 46928657) has the molecular formula C21H42N2O5 and a molecular weight of 402.58 g/mol. Its IUPAC name is 4,5-dibutoxy-1,3-bis(butoxymethyl)imidazolidin-2-one.
| Compound Name | 4,5-dibutoxy-1,3-bis(butoxymethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 46928657 |
| Molecular Formula | C21H42N2O5 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 4,5-dibutoxy-1,3-bis(butoxymethyl)imidazolidin-2-one |
| SMILES | CCCCOCN1C(=O)N(COCCCC)C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C21H42N2O5/c1-5-9-13-25-17-22-19(27-15-11-7-3)20(28-16-12-8-4)23(21(22)24)18-26-14-10-6-2/h19-20H,5-18H2,1-4H3 |
| InChIKey | SOCVXYGHHLXECK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|