C11H18O2 — CID 122370018
cis-(2R,3S)-3-butoxy-2-cyclopropylcyclobutan-1-one (PubChem CID 122370018) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is cis-(2R,3S)-3-butoxy-2-cyclopropylcyclobutan-1-one.
| Compound Name | cis-(2R,3S)-3-butoxy-2-cyclopropylcyclobutan-1-one |
|---|---|
| PubChem CID | 122370018 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | cis-(2R,3S)-3-butoxy-2-cyclopropylcyclobutan-1-one |
| SMILES | CCCCO[C@H]1CC(=O)[C@@H]1C1CC1 |
| InChI | InChI=1S/C11H18O2/c1-2-3-6-13-10-7-9(12)11(10)8-4-5-8/h8,10-11H,2-7H2,1H3/t10-,11-/m0/s1 |
| InChIKey | ZENWJQBSGTWZTK-QWRGUYRKSA-N |
| XLogP | 2.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|