About 5-butoxyazepan-3-one
5-butoxyazepan-3-one (PubChem CID 118248089) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 5-butoxyazepan-3-one.
Molecular Properties
| Compound Name | 5-butoxyazepan-3-one |
| PubChem CID | 118248089 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 5-butoxyazepan-3-one |
| SMILES | CCCCOC1CCNCC(=O)C1 |
| InChI | InChI=1S/C10H19NO2/c1-2-3-6-13-10-4-5-11-8-9(12)7-10/h10-11H,2-8H2,1H3 |
| InChIKey | ANFZLBCLOLRWNK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxyazepan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxyazepan-3-one?
The IUPAC name of 5-butoxyazepan-3-one (CID 118248089) is 5-butoxyazepan-3-one.
What is the SMILES notation for 5-butoxyazepan-3-one?
The canonical SMILES for 5-butoxyazepan-3-one is CCCCOC1CCNCC(=O)C1.
What is the InChIKey of 5-butoxyazepan-3-one?
The InChIKey is ANFZLBCLOLRWNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-2-3-6-13-10-4-5-11-8-9(12)7-10/h10-11H,2-8H2,1H3.
What are the key properties of 5-butoxyazepan-3-one?
5-butoxyazepan-3-one has a molecular weight of 185.27 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxyazepan-3-one is sourced from PubChem (CID 118248089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).