About 5-hexylazepan-3-one
5-hexylazepan-3-one (PubChem CID 57136018) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 5-hexylazepan-3-one.
Molecular Properties
| Compound Name | 5-hexylazepan-3-one |
| PubChem CID | 57136018 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 5-hexylazepan-3-one |
| SMILES | CCCCCCC1CCNCC(=O)C1 |
| InChI | InChI=1S/C12H23NO/c1-2-3-4-5-6-11-7-8-13-10-12(14)9-11/h11,13H,2-10H2,1H3 |
| InChIKey | TVLZYGASWORURM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexylazepan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexylazepan-3-one?
The IUPAC name of 5-hexylazepan-3-one (CID 57136018) is 5-hexylazepan-3-one.
What is the SMILES notation for 5-hexylazepan-3-one?
The canonical SMILES for 5-hexylazepan-3-one is CCCCCCC1CCNCC(=O)C1.
What is the InChIKey of 5-hexylazepan-3-one?
The InChIKey is TVLZYGASWORURM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-2-3-4-5-6-11-7-8-13-10-12(14)9-11/h11,13H,2-10H2,1H3.
What are the key properties of 5-hexylazepan-3-one?
5-hexylazepan-3-one has a molecular weight of 197.32 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexylazepan-3-one is sourced from PubChem (CID 57136018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).