C17H27NO4 — CID 18439127
1-[(1S,2S,3S)-2,3-dibutoxycyclopentyl]pyrrole-2,5-dione (PubChem CID 18439127) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-[(1S,2S,3S)-2,3-dibutoxycyclopentyl]pyrrole-2,5-dione.
| Compound Name | 1-[(1S,2S,3S)-2,3-dibutoxycyclopentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18439127 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-[(1S,2S,3S)-2,3-dibutoxycyclopentyl]pyrrole-2,5-dione |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)CC[C@@H]1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H27NO4/c1-3-5-11-21-14-8-7-13(17(14)22-12-6-4-2)18-15(19)9-10-16(18)20/h9-10,13-14,17H,3-8,11-12H2,1-2H3/t13-,14-,17-/m0/s1 |
| InChIKey | NTWRTXVVTVNNFI-ZQIUZPCESA-N |
| XLogP | 2.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|