C18H36N2O3 — CID 14836215
4,5-diethoxy-1-octyl-3-propylimidazolidin-2-one (PubChem CID 14836215) has the molecular formula C18H36N2O3 and a molecular weight of 328.50 g/mol. Its IUPAC name is 4,5-diethoxy-1-octyl-3-propylimidazolidin-2-one.
| Compound Name | 4,5-diethoxy-1-octyl-3-propylimidazolidin-2-one |
|---|---|
| PubChem CID | 14836215 |
| Molecular Formula | C18H36N2O3 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | 4,5-diethoxy-1-octyl-3-propylimidazolidin-2-one |
| SMILES | CCCCCCCCN1C(=O)N(CCC)C(OCC)C1OCC |
| InChI | InChI=1S/C18H36N2O3/c1-5-9-10-11-12-13-15-20-17(23-8-4)16(22-7-3)19(14-6-2)18(20)21/h16-17H,5-15H2,1-4H3 |
| InChIKey | XEHMXHCYVZRQDW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|