C19H37N2O5P — CID 86747818
5-diethoxyphosphoryl-1,3-dihexylimidazolidine-2,4-dione (PubChem CID 86747818) has the molecular formula C19H37N2O5P and a molecular weight of 404.49 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-1,3-dihexylimidazolidine-2,4-dione.
| Compound Name | 5-diethoxyphosphoryl-1,3-dihexylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86747818 |
| Molecular Formula | C19H37N2O5P |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 5-diethoxyphosphoryl-1,3-dihexylimidazolidine-2,4-dione |
| SMILES | CCCCCCN1C(=O)C(P(=O)(OCC)OCC)N(CCCCCC)C1=O |
| InChI | InChI=1S/C19H37N2O5P/c1-5-9-11-13-15-20-17(22)18(27(24,25-7-3)26-8-4)21(19(20)23)16-14-12-10-6-2/h18H,5-16H2,1-4H3 |
| InChIKey | PNZPWVRCYGQKCY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|