C8H18N2O — CID 142054543
1,4-diethyl-1,3-diazetidin-2-one;ethane (PubChem CID 142054543) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 1,4-diethyl-1,3-diazetidin-2-one;ethane.
| Compound Name | 1,4-diethyl-1,3-diazetidin-2-one;ethane |
|---|---|
| PubChem CID | 142054543 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 1,4-diethyl-1,3-diazetidin-2-one;ethane |
| SMILES | CC.CCC1NC(=O)N1CC |
| InChI | InChI=1S/C6H12N2O.C2H6/c1-3-5-7-6(9)8(5)4-2;1-2/h5H,3-4H2,1-2H3,(H,7,9);1-2H3 |
| InChIKey | LQTZCCCDALEUTR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |