C7H14N2O3 — CID 166073631
ethane;5-ethyl-3-hydroxyimidazolidine-2,4-dione (PubChem CID 166073631) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is ethane;5-ethyl-3-hydroxyimidazolidine-2,4-dione.
| Compound Name | ethane;5-ethyl-3-hydroxyimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166073631 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | ethane;5-ethyl-3-hydroxyimidazolidine-2,4-dione |
| SMILES | CC.CCC1NC(=O)N(O)C1=O |
| InChI | InChI=1S/C5H8N2O3.C2H6/c1-2-3-4(8)7(10)5(9)6-3;1-2/h3,10H,2H2,1H3,(H,6,9);1-2H3 |
| InChIKey | RBFZFMSFJMPHKJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|