C8H14N2O2 — CID 64881885
3-ethyl-1-methyl-1,4-diazepane-2,5-dione (PubChem CID 64881885) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1,4-diazepane-2,5-dione.
| Compound Name | 3-ethyl-1-methyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64881885 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-ethyl-1-methyl-1,4-diazepane-2,5-dione |
| SMILES | CCC1NC(=O)CCN(C)C1=O |
| InChI | InChI=1S/C8H14N2O2/c1-3-6-8(12)10(2)5-4-7(11)9-6/h6H,3-5H2,1-2H3,(H,9,11) |
| InChIKey | SJTNNFGTDIJGAC-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |