C12H22N2O4S — CID 106733796
3-ethyl-1-(2-propan-2-ylsulfonylethyl)-1,4-diazepane-2,5-dione (PubChem CID 106733796) has the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. Its IUPAC name is 3-ethyl-1-(2-propan-2-ylsulfonylethyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-ethyl-1-(2-propan-2-ylsulfonylethyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 106733796 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-ethyl-1-(2-propan-2-ylsulfonylethyl)-1,4-diazepane-2,5-dione |
| SMILES | CCC1NC(=O)CCN(CCS(=O)(=O)C(C)C)C1=O |
| InChI | InChI=1S/C12H22N2O4S/c1-4-10-12(16)14(6-5-11(15)13-10)7-8-19(17,18)9(2)3/h9-10H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | MDKNPGFWDAORCC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |