About 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one
5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one (PubChem CID 174407572) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one |
| PubChem CID | 174407572 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one |
| SMILES | CCCCN1C(C)=C(N)C(=O)NC1CC |
| InChI | InChI=1S/C11H21N3O/c1-4-6-7-14-8(3)10(12)11(15)13-9(14)5-2/h9H,4-7,12H2,1-3H3,(H,13,15) |
| InChIKey | HRTZKNYVHJJIJO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one?
The IUPAC name of 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one (CID 174407572) is 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one.
What is the SMILES notation for 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one?
The canonical SMILES for 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one is CCCCN1C(C)=C(N)C(=O)NC1CC.
What is the InChIKey of 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one?
The InChIKey is HRTZKNYVHJJIJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-4-6-7-14-8(3)10(12)11(15)13-9(14)5-2/h9H,4-7,12H2,1-3H3,(H,13,15).
What are the key properties of 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one?
5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one has a molecular weight of 211.31 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-butyl-2-ethyl-4-methyl-1,2-dihydropyrimidin-6-one is sourced from PubChem (CID 174407572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).