C8H16N4O2 — CID 139517179
4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one (PubChem CID 139517179) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one.
| Compound Name | 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 139517179 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one |
| SMILES | CCCCN1C(N)=C(N)C(=O)NC1O |
| InChI | InChI=1S/C8H16N4O2/c1-2-3-4-12-6(10)5(9)7(13)11-8(12)14/h8,14H,2-4,9-10H2,1H3,(H,11,13) |
| InChIKey | UEQKHQIBUSTXBX-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |