About 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one
4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one (PubChem CID 139517179) has the molecular formula C8H16N4O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one |
| PubChem CID | 139517179 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one |
| SMILES | CCCCN1C(N)=C(N)C(=O)NC1O |
| InChI | InChI=1S/C8H16N4O2/c1-2-3-4-12-6(10)5(9)7(13)11-8(12)14/h8,14H,2-4,9-10H2,1H3,(H,11,13) |
| InChIKey | UEQKHQIBUSTXBX-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one?
The IUPAC name of 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one (CID 139517179) is 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one.
What is the SMILES notation for 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one?
The canonical SMILES for 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one is CCCCN1C(N)=C(N)C(=O)NC1O.
What is the InChIKey of 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one?
The InChIKey is UEQKHQIBUSTXBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O2/c1-2-3-4-12-6(10)5(9)7(13)11-8(12)14/h8,14H,2-4,9-10H2,1H3,(H,11,13).
What are the key properties of 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one?
4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one has a molecular weight of 200.24 g/mol, XLogP of -1.42, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diamino-3-butyl-2-hydroxy-1,2-dihydropyrimidin-6-one is sourced from PubChem (CID 139517179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).