C6H11IN2O — CID 148908542
1-ethyl-6-iodo-1,3-diazinan-2-one (PubChem CID 148908542) has the molecular formula C6H11IN2O and a molecular weight of 254.07 g/mol. Its IUPAC name is 1-ethyl-6-iodo-1,3-diazinan-2-one.
| Compound Name | 1-ethyl-6-iodo-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 148908542 |
| Molecular Formula | C6H11IN2O |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 1-ethyl-6-iodo-1,3-diazinan-2-one |
| SMILES | CCN1C(=O)NCCC1I |
| InChI | InChI=1S/C6H11IN2O/c1-2-9-5(7)3-4-8-6(9)10/h5H,2-4H2,1H3,(H,8,10) |
| InChIKey | PIEBAJMIGVGPER-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|