C7H8N2O4PV+ — CID 157095936
2-ethyl-6-methyl-2,6-diaza-4-phosphoniaspiro[3.3]heptane-1,3,5,7-tetrone;vanadium (PubChem CID 157095936) has the molecular formula C7H8N2O4PV+ and a molecular weight of 266.07 g/mol. Its IUPAC name is 2-ethyl-6-methyl-2,6-diaza-4-phosphoniaspiro[3.3]heptane-1,3,5,7-tetrone;vanadium.
| Compound Name | 2-ethyl-6-methyl-2,6-diaza-4-phosphoniaspiro[3.3]heptane-1,3,5,7-tetrone;vanadium |
|---|---|
| PubChem CID | 157095936 |
| Molecular Formula | C7H8N2O4PV+ |
| Molecular Weight | 266.07 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | 2-ethyl-6-methyl-2,6-diaza-4-phosphoniaspiro[3.3]heptane-1,3,5,7-tetrone;vanadium |
| SMILES | CCN1C(=O)[P+]2(C(=O)N(C)C2=O)C1=O.[V] |
| InChI | InChI=1S/C7H8N2O4P.V/c1-3-9-6(12)14(7(9)13)4(10)8(2)5(14)11;/h3H2,1-2H3;/q+1; |
| InChIKey | VWOFCLOHDYPPSW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.07 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|