C11H20N2O2 — CID 59872521
(3S)-1,3,4-triethyl-1,4-diazepane-2,5-dione (PubChem CID 59872521) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3S)-1,3,4-triethyl-1,4-diazepane-2,5-dione.
| Compound Name | (3S)-1,3,4-triethyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 59872521 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (3S)-1,3,4-triethyl-1,4-diazepane-2,5-dione |
| SMILES | CC[C@H]1C(=O)N(CC)CCC(=O)N1CC |
| InChI | InChI=1S/C11H20N2O2/c1-4-9-11(15)12(5-2)8-7-10(14)13(9)6-3/h9H,4-8H2,1-3H3/t9-/m0/s1 |
| InChIKey | GITVHICPCAUBMF-VIFPVBQESA-N |
| XLogP | 0.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |