C5H8IN3O3 — CID 130409702
6-hydroxy-1-iodo-3,5-dimethyl-1,3,5-triazinane-2,4-dione (PubChem CID 130409702) has the molecular formula C5H8IN3O3 and a molecular weight of 285.04 g/mol. Its IUPAC name is 6-hydroxy-1-iodo-3,5-dimethyl-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-hydroxy-1-iodo-3,5-dimethyl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 130409702 |
| Molecular Formula | C5H8IN3O3 |
| Molecular Weight | 285.04 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | 6-hydroxy-1-iodo-3,5-dimethyl-1,3,5-triazinane-2,4-dione |
| SMILES | CN1C(=O)N(C)C(O)N(I)C1=O |
| InChI | InChI=1S/C5H8IN3O3/c1-7-3(10)8(2)5(12)9(6)4(7)11/h4,11H,1-2H3 |
| InChIKey | VDKWFJNSJFBAHY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.04 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|