C7H12N2O4 — CID 102238626
(5S,6R)-5,6-dihydroxy-1,3,5-trimethyl-1,3-diazinane-2,4-dione (PubChem CID 102238626) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is (5S,6R)-5,6-dihydroxy-1,3,5-trimethyl-1,3-diazinane-2,4-dione.
| Compound Name | (5S,6R)-5,6-dihydroxy-1,3,5-trimethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 102238626 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (5S,6R)-5,6-dihydroxy-1,3,5-trimethyl-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)N(C)[C@H](O)[C@](C)(O)C1=O |
| InChI | InChI=1S/C7H12N2O4/c1-7(13)4(10)8(2)6(12)9(3)5(7)11/h4,10,13H,1-3H3/t4-,7+/m1/s1 |
| InChIKey | JJKIAXWKABADES-FBCQKBJTSA-N |
| XLogP | -1.42 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |